Home
Products
alpha-L-Rhamnose
| Product Name | alpha-L-Rhamnose |
| Price: | Inquiry |
| Catalog No.: | CN06592 |
| CAS No.: | 3615-41-6 |
| Molecular Formula: | C6H12O5 |
| Molecular Weight: | 164.16 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Powder |
| Source: | The leaves of Rhus toxicodendron |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | O=C[C@@H]([C@@H]([C@H]([C@@H](O)C)O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Rhamnose (L-Rhamnose) is a monosaccharide found in plants and bacteria. Rhamnose-conjugated immunogens is used in immunotherapies[1]. Rhamnose crosses the epithelia via the transcellular pathway and acts as a marker of intestinal absorption[2]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 323.9±42.0 °C at 760 mmHg |
| Flash Point | 149.7±27.9 °C |
| Exact Mass | 164.068466 |
| PSA | 90.15000 |
| LogP | -0.34 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |