Home
Products
D-(+)-Fucose
| Product Name | D-(+)-Fucose |
| Price: | Inquiry |
| Catalog No.: | CN06517 |
| CAS No.: | 3615-37-0 |
| Molecular Formula: | C6H12O5 |
| Molecular Weight: | 164.16 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Powder |
| Source: | From brown algae. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C[C@@H]([C@H]([C@H]([C@H](O)C)O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | D-(+)-Fucose is a nonmetabolizable analogue of l-arabinose. D-(+)-Fucose prevents growth of Escherichia coli B/r on a mineral salts medium plus l-arabinose by inhibiting induction of the l-arabinose operon[1]. D-fucose is a potent inducer of beta-methylgalactoside permease (MGP)[2]. |
| Density | 1.41 g/cm3 |
| Boiling Point | 399.1ºC at 760 mmHg |
| Flash Point | 209.3ºC |
| Exact Mass | 164.06800 |
| PSA | 90.15000 |