Home
Products
Sodium cholate
| Product Name | Sodium cholate |
| Price: | Inquiry |
| Catalog No.: | CN02387 |
| CAS No.: | 361-09-1 |
| Molecular Formula: | C24H39NaO5 |
| Molecular Weight: | 430.55 g/mol |
| Purity: | >=98% |
| Type of Compound: | Steroids |
| Physical Desc.: | Powder |
| Source: | The bile of pig. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC1CCC2(C(C1)CC(C1C2CC(O)C2(C1CCC2C(CCC(=O)[O-])C)C)O)C.[Na+] |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Cholic acid sodium is a major primary bile acid produced in the liver and usually conjugated with glycine or taurine. It facilitates fat absorption and cholesterol excretion. |
| In Vitro | Cholic acid competitively binds Na+/taurocholate cotransporting polypeptide (NTCP) on HepG2 cells and significantly inhibits the uptake of Cholic acid (CA)-nanoliposomes (LPs)-Doxorubicin (DOX)-HCl, which indicates that CA-LPs-DOX-HCl are also uptaken via NTCP-mediated endocytosis pathway[1]. |
| Cell Assay | HepG2 cells are pretreated with the inhibitors NaN3 (1 mg/mL), Genistein (50 μg/mL), MβCD (10 mM), Nystatin (50 μg/mL), Chlorpromazine (10 μg/mL), and Cholic acid (1 mg/mL) for 30 min. After removing the inhibitors, the cells are incubated with CA-LPs for 2 h, and the cellular uptake of LPs is determined in the "In vitro cellular uptake assays" section[1]. |
| Boiling Point | 583.9ºC at 760 mmHg |
| Flash Point | 321ºC |
| Exact Mass | 430.269531 |
| PSA | 100.82000 |
| LogP | 2.11400 |