Home
Products
Alpinetin
| Product Name | Alpinetin |
| Price: | $40 / 20mg |
| Catalog No.: | CN05390 |
| CAS No.: | 36052-37-6 |
| Molecular Formula: | C16H14O4 |
| Molecular Weight: | 270.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The fruits of Alpinia katsumadai. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(O)cc2c1C(=O)C[C@H](O2)c1ccccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Alpinetin is a flavonoid isolated from Alpinia katsumadai Hayata, activates activates PPAR-γ, with potent anti-inflammatory activity[1]. |
| Target | PPAR-γ |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 494.9±45.0 °C at 760 mmHg |
| Flash Point | 188.8±22.2 °C |
| Exact Mass | 270.089203 |
| PSA | 55.76000 |
| LogP | 3.71 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |