Home
Products
Glycodeoxycholic acid
| Product Name | Glycodeoxycholic acid |
| Price: | Inquiry |
| Catalog No.: | CN02381 |
| CAS No.: | 360-65-6 |
| Molecular Formula: | C26H43NO5 |
| Molecular Weight: | 449.63 g/mol |
| Purity: | >=98% |
| Type of Compound: | Steroids |
| Physical Desc.: | Powder |
| Source: | The derivatives of deoxycholic acid and glycine. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O[C@@H]1CC[C@]2(C(C1)CC[C@@H]1[C@@H]2C[C@H](O)[C@]2([C@H]1CC[C@@H]2[C@@H](CCC(=O)NCC(=O)O)C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.162 g/cm3 |
| Boiling Point | 655.6ºC at 760 mmHg |
| Flash Point | 350.3ºC |
| Exact Mass | 467.32500 |
| PSA | 116.09000 |
| LogP | 3.92070 |