Home
Products
Chrysin 7-O-beta-D-glucopyranuronoside
| Product Name | Chrysin 7-O-beta-D-glucopyranuronoside |
| Price: | $196 / 5mg |
| Catalog No.: | CN05077 |
| CAS No.: | 35775-49-6 |
| Molecular Formula: | C21H18O10 |
| Molecular Weight: | 430.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The roots of Astragalus membranaceus |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC(=O)C1OC(Oc2cc(O)c3c(c2)oc(cc3=O)c2ccccc2)C(C(C1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Chrysin-7-O-glucuronide is a flavonoid extracted from Scutellaria baicalensis, with antioxidant activity[1]. |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 787.8±60.0 °C at 760 mmHg |
| Flash Point | 281.2±26.4 °C |
| Exact Mass | 430.089996 |
| LogP | 0.23 |
| Vapour Pressure | 0.0±2.9 mmHg at 25°C |