Home
Products
Oxyimperatorin
| Product Name | Oxyimperatorin |
| Price: | $234 / 10mg |
| Catalog No.: | CN06146 |
| CAS No.: | 35740-18-2 |
| Molecular Formula: | C16H14O5 |
| Molecular Weight: | 286.28 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | Cryst. |
| Source: | The roots of Angelica dahurica |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=c1ccc2c(o1)c(OCC1OC1(C)C)c1c(c2)cco1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Oxyimperatorin ((±)-Heraclenin) is a coumarin isolated from Angelica dahurica. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 471.4±45.0 °C at 760 mmHg |
| Flash Point | 238.9±28.7 °C |
| Exact Mass | 286.084137 |
| PSA | 65.11000 |
| LogP | 1.67 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Storage condition | 2-8℃ |