Home
Products
Moslosooflavone
| Product Name | Moslosooflavone |
| Price: | $117 / 10mg |
| Catalog No.: | CN05392 |
| CAS No.: | 3570-62-5 |
| Molecular Formula: | C17H14O5 |
| Molecular Weight: | 298.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Mosla soochouensis Matsuda |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1c(OC)cc(c2c1oc(cc2=O)c1ccccc1)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Moslosooflavone is a flavonoid isolated from Saussurea involucrata. Moslosooflavone has an anti-hypoxia and anti-inflammatory activities[1]. |
| In Vitro | Moslosooflavone can significantly inhibits the transcriptional activity of NF-kappaB in LPS/IFN-gamma stimulated RAW 264.7 macrophages[2]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 532.9±50.0 °C at 760 mmHg |
| Flash Point | 200.6±23.6 °C |
| Exact Mass | 298.084137 |
| PSA | 68.90000 |
| LogP | 2.52 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |