Home
Products
Albaspidin AA
| Product Name | Albaspidin AA |
| Price: | $293 / 10mg |
| Catalog No.: | CN04047 |
| CAS No.: | 3570-40-9 |
| Molecular Formula: | C21H24O8 |
| Molecular Weight: | 404.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Yellow powder |
| Source: | The rhizomes of Dryopteris crassirhizoma Nakai |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | CC(=O)C1=C(O)C(C(=C(C1=O)CC1=C(O)C(C(=C(C1=O)C(=O)C)O)(C)C)O)(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Albaspidin AA displays strong antibacterial activity against the vegetative form of Paenibacillus larvae (P. larvae) (MIC=220 μM)[1]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 649.1±55.0 °C at 760 mmHg |
| Flash Point | 360.4±28.0 °C |
| Exact Mass | 404.147125 |
| PSA | 149.20000 |
| LogP | 2.12 |
| Vapour Pressure | 0.0±4.4 mmHg at 25°C |