Home
Products
Deoxylapachol
| Product Name | Deoxylapachol |
| Price: | Inquiry |
| Catalog No.: | CN05907 |
| CAS No.: | 3568-90-9 |
| Molecular Formula: | C15H14O2 |
| Molecular Weight: | 226.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Quinones |
| Physical Desc.: | Yellow oil |
| Source: | The leaves of Catalpa ovata G. Don. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=CCC1=CC(=O)c2c(C1=O)cccc2)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Deoxylapachol is a major cytotoxic component of New Zealand brown alga, Landsburgia quercifolia. Deoxylapachol has antifungal and anti-cancer activity[1]. |
| In Vitro | Deoxylapachol is active against P-388 leukemia cells (IC50=0.6 microgm/ml). |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 359.2±42.0 °C at 760 mmHg |
| Flash Point | 134.8±24.9 °C |
| Exact Mass | 226.099380 |
| PSA | 34.14000 |
| LogP | 4.24 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Storage condition | 2-8℃ |