Home
Products
SB525334
| Product Name | SB525334 |
| Price: | Inquiry |
| Catalog No.: | CN00414 |
| CAS No.: | 356559-20-1 |
| Molecular Formula: | C21H21N5 |
| Molecular Weight: | 343.42 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Cc1cccc(n1)c1[nH]c(nc1c1ccc2c(c1)nccn2)C(C)(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | SB 525334 is a potent and selective transforming growth factor β1 receptor (ALK5) inhibitor with an IC50 of 14.3 nM. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 540.5±45.0 °C at 760 mmHg |
| Flash Point | 238.6±21.7 °C |
| Exact Mass | 343.179688 |
| PSA | 67.35000 |
| LogP | 4.05 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Storage condition | 2-8°C |