Home
Products
Ki16425
| Product Name | Ki16425 |
| Price: | Inquiry |
| Catalog No.: | CN00238 |
| CAS No.: | 355025-24-0 |
| Molecular Formula: | C23H23ClN2O5S |
| Molecular Weight: | 474.96 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC(=O)CCSCc1ccc(cc1)c1onc(c1NC(=O)OC(c1ccccc1Cl)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Ki16425 is a subtype-selective, competitive antagonist of the EDG-family receptors, LPA1 and LPA3 with Kis of 0.34 μM and 0.93 μM, respectively. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 623.7±55.0 °C at 760 mmHg |
| Flash Point | 331.0±31.5 °C |
| Exact Mass | 474.101624 |
| PSA | 126.96000 |
| LogP | 4.63 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Storage condition | 2-8°C |