Home
Products
Hirsuteine
| Product Name | Hirsuteine |
| Price: | $204 / 5mg |
| Catalog No.: | CN01094 |
| CAS No.: | 35467-43-7 |
| Molecular Formula: | C22H26N2O3 |
| Molecular Weight: | 366.45 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The herbs of Uncaria rhynchophylla |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COC=C(C1CC2N(CC1C=C)CCc1c2[nH]c2c1cccc2)C(=O)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Hirsuteine is an indole alkaloid extracted from Uncaria genus. Hirsuteine non-competitively antagonizes nicotine-mediated dopamine release by blocking ion permeation through nicotinic receptor channel complexes[1]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 533.2±50.0 °C at 760 mmHg |
| Flash Point | 276.3±30.1 °C |
| Exact Mass | 366.194336 |
| PSA | 54.56000 |
| LogP | 3.75 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |