Home
Products
4-Bromomethyl-7-methoxycoumarin
| Product Name | 4-Bromomethyl-7-methoxycoumarin |
| Price: | Inquiry |
| Catalog No.: | CN06042 |
| CAS No.: | 35231-44-8 |
| Molecular Formula: | C11H9BrO3 |
| Molecular Weight: | 269.0 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | Powder |
| Source: | |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1ccc2c(c1)oc(=O)cc2CBr |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Br-Mmc (4-Bromomethyl-7-methoxycoumarin) is often used as fluorescent label for the determination of compounds possessing a carboxylic group. Br-Mmc is used for the determination fatty acids by TLC or HPLC[1][2][3]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 385.3±42.0 °C at 760 mmHg |
| Flash Point | 186.8±27.9 °C |
| Exact Mass | 267.973511 |
| PSA | 39.44000 |
| LogP | 2.73 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Storage condition | 2-8°C |