Home
Products
D-Tetrahydropalmatine
| Product Name | D-Tetrahydropalmatine |
| Price: | Inquiry |
| Catalog No.: | CN01408 |
| CAS No.: | 3520-14-7 |
| Molecular Formula: | C21H25NO4 |
| Molecular Weight: | 355.41 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The barks of Phellodendron chinense Schneid. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc2CCN3[C@@H](c2cc1OC)Cc1c(C3)c(OC)c(cc1)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | D-Tetrahydropalmatine is an isoquinoline alkaloid, mainly in the genus Corydalis[1]. D-Tetrahydropalmatine is a Dopamine (DA) receptor antagonist with preferential affinity toward the D1 receptors[2]. D-Tetrahydropalmatine is a potent organic cation transporter 1 (OCT1) inhibitor[3]. |
| Target | DA[2], OCT1[3] |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 482.9±45.0 °C at 760 mmHg |
| Flash Point | 138.7±25.9 °C |
| Exact Mass | 355.178345 |
| PSA | 40.16000 |
| LogP | 3.70 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |