Home
Products
Isopropylidenylacetyl-marmesin
| Product Name | Isopropylidenylacetyl-marmesin |
| Price: | Inquiry |
| Catalog No.: | CN06122 |
| CAS No.: | 35178-20-2 |
| Molecular Formula: | C19H20O5 |
| Molecular Weight: | 328.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | Powder |
| Source: | The roots of Notopterygium incisum |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=CC(=O)OC(C1Oc2c(C1)cc1c(c2)oc(=O)cc1)(C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Isopropylidenylacetyl-marmesin ((±)-Prantschimgin) is a coumarin isolated from the roots of F. bracteata[1]. |
| Density | 1.232±0.06 g/cm3(Predicted) |
| Boiling Point | 475.6±45.0 °C(Predicted) |