Home
Products
Isodemethylwedelolacton
| Product Name | Isodemethylwedelolacton |
| Price: | $176 / 20mg |
| Catalog No.: | CN06145 |
| CAS No.: | 350681-33-3 |
| Molecular Formula: | C15H8O7 |
| Molecular Weight: | 300.22 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Eclipta prostrata |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1cc(O)c2c(c1)c1oc3c(c1c(=O)o2)cc(c(c3)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Isodemethylwedelolactone is a kind of procoagulant and haemolytic constituent isolated from Eclipta alba[1]. |
| Density | 1.8±0.1 g/cm3 |
| Boiling Point | 531.4±35.0 °C at 760 mmHg |
| Flash Point | 275.2±25.9 °C |
| Exact Mass | 300.027008 |
| LogP | 1.14 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |