Home
Products
Kurarinone
| Product Name | Kurarinone |
| Price: | $77 / 5mg |
| Catalog No.: | CN05151 |
| CAS No.: | 34981-26-5 |
| Molecular Formula: | C26H30O6 |
| Molecular Weight: | 438.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The roots of Sophora flavescens Ait. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(O)c(c2c1C(=O)C[C@H](O2)c1ccc(cc1O)O)C[C@H](C(=C)C)CC=C(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Kurarinone, a flavanoid derived from shrub Sophora flavescens, inhibits the process of experimental autoimmune encephalomyelitis via blocking Th1 and Th17 cell differentiation[1]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 651.4±55.0 °C at 760 mmHg |
| Flash Point | 219.0±25.0 °C |
| Exact Mass | 438.204254 |
| PSA | 96.22000 |
| LogP | 6.30 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |