Home
Products
1-Methoxycarbonyl-beta-carboline
| Product Name | 1-Methoxycarbonyl-beta-carboline |
| Price: | $234 / 5mg |
| Catalog No.: | CN02052 |
| CAS No.: | 3464-66-2 |
| Molecular Formula: | C13H10N2O2 |
| Molecular Weight: | 226.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Yellow powder |
| Source: | The leaves of Ailanthus altissima |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COC(=O)c1nccc2c1[nH]c1c2cccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 1-Methoxycarbonyl-β-carboline is a natural alkaloid[1]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 466.7±25.0 °C at 760 mmHg |
| Flash Point | 236.1±23.2 °C |
| Exact Mass | 226.074234 |
| PSA | 54.98000 |
| LogP | 2.58 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |