Home
Products
Maltohexaose
| Product Name | Maltohexaose |
| Price: | Inquiry |
| Catalog No.: | CN06524 |
| CAS No.: | 34620-77-4 |
| Molecular Formula: | C36H62O31 |
| Molecular Weight: | 990.9 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Powder |
| Source: | From brewpub beer carbohydrates. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H]([C@@H]([C@H]2O)O)O[C@@H]2[C@@H](CO)O[C@@H]([C@@H]([C@H]2O)O)O)[C@@H]([C@H]([C@@H]1O[C@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O[C@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O[C@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Maltohexaose is a natural saccharide, and can be produced from amylose, amylopectin and whole starch. |
| Density | 1.87g/cm3 |
| Boiling Point | 1307.8ºC at 760mmHg |
| Flash Point | 744.7ºC |
| Exact Mass | 990.32800 |
| PSA | 506.13000 |
| Storage condition | Refrigerator |