Home
Products
Maltotetraose
| Product Name | Maltotetraose |
| Price: | $234 / 20mg |
| Catalog No.: | CN06525 |
| CAS No.: | 34612-38-9 |
| Molecular Formula: | C24H42O21 |
| Molecular Weight: | 666.6 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Powder |
| Source: | From brewpub beer carbohydrates. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H]([C@@H]([C@H]2O)O)O)[C@@H]([C@H]([C@@H]1O[C@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O[C@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Maltotetraose can be used as a substrate for the enzyme-coupled determination of amylase activity in biological fluids. |
| Target | Human Endogenous Metabolite |
| Density | 1.8±0.1 g/cm3 |
| Boiling Point | 1030.9±65.0 °C at 760 mmHg |
| Flash Point | 577.3±34.3 °C |
| Exact Mass | 666.221863 |
| PSA | 347.83000 |
| LogP | -5.83 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Storage condition | 2~8°C |