Home
Products
Beta,beta-Dimethylacrylalkannin
| Product Name | Beta,beta-Dimethylacrylalkannin |
| Price: | $117 / 20mg |
| Catalog No.: | CN05881 |
| CAS No.: | 34539-65-6 |
| Molecular Formula: | C21H22O6 |
| Molecular Weight: | 370.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Quinones |
| Physical Desc.: | Reddish brown powder |
| Source: | The roots of Lithospermum erythrorhizon |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=CC[C@@H](C1=CC(=O)c2c(C1=O)c(O)ccc2O)OC(=O)C=C(C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | β,β-Dimethylacrylalkannin is a napthoquinone isolated from Arnebia nobilis Reichb.f, increases collagen and involucrin content in skin cells[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 573.9±50.0 °C at 760 mmHg |
| Flash Point | 201.1±23.6 °C |
| Exact Mass | 370.141632 |
| PSA | 100.90000 |
| LogP | 5.98 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Storage condition | 2~8℃ |