Home
Products
Lathyrol
| Product Name | Lathyrol |
| Price: | $62 / 20mg |
| Catalog No.: | CN08861 |
| CAS No.: | 34420-19-4 |
| Molecular Formula: | C20H30O4 |
| Molecular Weight: | 334.45 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | White powder |
| Source: | The seeds of Euphorbia lathyris L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C=C1CC[C@H]2[C@H](C2(C)C)/C=C(C(=O)[C@@]2([C@@H]([C@H]1O)[C@@H](O)[C@H](C2)C)O)/C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Lathyrol is a natural product, and is used for cancer treatment. |
| In Vitro | Lathyrol exhibits reversal effects in MCF-7/ADR breast cancer cell lines in vitro[1]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 503.5±50.0 °C at 760 mmHg |
| Flash Point | 272.4±26.6 °C |
| Exact Mass | 334.214417 |
| PSA | 77.76000 |
| LogP | 2.69 |
| Vapour Pressure | 0.0±2.9 mmHg at 25°C |
| Storage condition | 2-8C |