Home
Products
Chelerythrine
| Product Name | Chelerythrine |
| Price: | $43 / 20mg |
| Catalog No.: | CN02055 |
| CAS No.: | 34316-15-9 |
| Molecular Formula: | C21H18NO4 |
| Molecular Weight: | 348.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Chelidonium majus |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1c(OC)ccc2c1c[n+](C)c1c2ccc2c1cc1OCOc1c2 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Chelerythrine is a natural alkaloid, acts as a potent and selective Ca2+/phospholopid-dependent PKC antagonist, with an IC50 of 0.7 μM[1]. Chelerythrine has antitumor, antidiabetic and anti-inflammatory activity[2]. |
| Target | PKC:0.7 μM (IC50) |
| Exact Mass | 348.123047 |
| PSA | 40.80000 |
| LogP | 0.72060 |
| Storage condition | Desiccate at -20°C |