Home
Products
Rhein-8-glucoside
| Product Name | Rhein-8-glucoside |
| Price: | $263 / 10mg |
| Catalog No.: | CN05942 |
| CAS No.: | 34298-86-7 |
| Molecular Formula: | C21H18O11 |
| Molecular Weight: | 446.36 g/mol |
| Purity: | >=98% |
| Type of Compound: | Anthraquinones |
| Physical Desc.: | Powder |
| Source: | The roots of Rheum palmatum L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2cccc3c2C(=O)c2c(C3=O)cc(cc2O)C(=O)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Rhein 8-Glucoside (Rhein 8-O-β-D-Glucopyranoside) is an anthraquinone glycoside that has been found in rhubarb. Purgative activity[1]. |
| Exact Mass | 446.08500 |
| PSA | 191.05000 |
| Storage condition | 2-8℃ |