Home
Products
7-beta-Hydroxylathyrol
| Product Name | 7-beta-Hydroxylathyrol |
| Price: | $176 / 20mg |
| Catalog No.: | CN08499 |
| CAS No.: | 34208-98-5 |
| Molecular Formula: | C20H30O5 |
| Molecular Weight: | 350.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The seeds of Euphorbia lathyris L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O[C@@H]1C[C@H]2[C@H](C2(C)C)/C=C(C(=O)[C@@]2([C@@H]([C@H](C1=C)O)[C@@H](O)[C@H](C2)C)O)/C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 7beta-Hydroxylathyrol is a natural product. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 548.6±50.0 °C at 760 mmHg |
| Flash Point | 299.7±26.6 °C |
| Exact Mass | 350.209320 |
| PSA | 97.99000 |
| LogP | 1.04 |
| Vapour Pressure | 0.0±3.3 mmHg at 25°C |
| Storage condition | -20°C |