Home
Products
Flavokawain A
| Product Name | Flavokawain A |
| Price: | Inquiry |
| Catalog No.: | CN05685 |
| CAS No.: | 3420-72-2 |
| Molecular Formula: | C18H18O5 |
| Molecular Weight: | 314.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Chalcones |
| Physical Desc.: | Yellow powder |
| Source: | The roots of Piper methysticum |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1ccc(cc1)/C=C/C(=O)c1c(O)cc(cc1OC)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Flavokawain A, a proming anticarcinogenic agent, is a chalcone from kava extract with anti-tumor activity. Flavokawain A induces cell apoptosis by involvement of Bax protein-dependent and mitochondria-dependent apoptotic pathway. Flavokawain A has the potential for the study of bladder cancer[1]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 529.9±50.0 °C at 760 mmHg |
| Flash Point | 193.2±23.6 °C |
| Exact Mass | 314.115417 |
| PSA | 64.99000 |
| LogP | 3.96 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |