Home
Products
Pterosin B
| Product Name | Pterosin B |
| Price: | Inquiry |
| Catalog No.: | CN09216 |
| CAS No.: | 34175-96-7 |
| Molecular Formula: | C14H18O2 |
| Molecular Weight: | 218.29 g/mol |
| Purity: | >=98% |
| Type of Compound: | Sesquiterpenoids |
| Physical Desc.: | Powder |
| Source: | The aerial parts of Pteris semipinnata. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OCCc1c(C)cc2c(c1C)C(=O)[C@@H](C2)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Pterosin B, a indanone found in bracken fern (Pteridium aquilinum), is an inhibitor of salt-inducible kinase 3 (Sik3) signaling. Pterosin B prevents chondrocyte hypertrophy and osteoarthritis in mice by inhibiting Sik3[1][2]. |
| Target | SIK3 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 396.5±41.0 °C at 760 mmHg |
| Flash Point | 169.3±20.2 °C |
| Exact Mass | 218.130676 |
| PSA | 37.30000 |
| LogP | 2.65 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |