Home
Products
Glycyrrhetic acid 3-O-mono-beta-D-glucuronide
| Product Name | Glycyrrhetic acid 3-O-mono-beta-D-glucuronide |
| Price: | $204 / 10mg |
| Catalog No.: | CN07558 |
| CAS No.: | 34096-83-8 |
| Molecular Formula: | C36H54O10 |
| Molecular Weight: | 646.8 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Glycyrrhiza uralensis Fisch |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | O[C@@H]1[C@@H](O)[C@@H](O[C@@H]([C@H]1O)C(=O)O)O[C@H]1CC[C@]2([C@H](C1(C)C)CC[C@@]1([C@@H]2C(=O)C=C2[C@@]1(C)CC[C@@]1([C@H]2C[C@](C)(CC1)C(=O)O)C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Glycyrrhetic acid 3-O-β-D-glucuronide, isolated from glycyrrhiza, is an important derivative of glycyrrhizin (GL) with an anti -allergic activity[1]. Glycyrrhetic acid 3-O-β-D-glucuronide (GAMG) shows that β‐glucuronidases (β‐GUS) are key GAMG-producing enzymes, displaying a high potential to convert GL directly into GAMG[2].Glycyrrhetic acid 3-O-β-D-glucuronide is valuable as a sweetener. |
| In Vitro | Glycyrrhetic acid 3-O-β-D-glucuronide can inhibit the release of β‐hexosaminidase from RBL‐2H3 cells with an IC50 value of 0.28 mM[2]. Glycyrrhetic acid 3-O-β-D-glucuronide (GAMG) significantly reduces the nitrite concentration in a dose-dependent manner with an IC50 value of 120 μM in LPS‐induced RAW264.7 cells[2]. |
| Density | 1.31g/cm3 |
| Boiling Point | 785ºC at 760mmHg |
| Flash Point | 240.7ºC |
| Exact Mass | 646.37200 |
| PSA | 170.82000 |
| LogP | 4.32910 |