Home
Products
7-O-Methylbiochanin A
| Product Name | 7-O-Methylbiochanin A |
| Price: | Inquiry |
| Catalog No.: | CN04549 |
| CAS No.: | 34086-51-6 |
| Molecular Formula: | C17H14O5 |
| Molecular Weight: | 298.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Trifolium pretense L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1ccc(cc1)c1coc2c(c1=O)c(O)cc(c2)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 7-O-Methylbiochanin A (4',7-Dimethoxy-5-hydroxyisoflavone) is an isoflavone derivative isolated from the roots of Lotus polyphyllos[1]. |
| Density | 1.321 g/cm3 |
| Boiling Point | 515.2ºC at 760 mmHg |
| Exact Mass | 298.08400 |
| PSA | 68.90000 |
| LogP | 3.18280 |