Home
Products
Triacetonamine hydrochloride
| Product Name | Triacetonamine hydrochloride |
| Price: | Inquiry |
| Catalog No.: | CN02057 |
| CAS No.: | 33973-59-0 |
| Molecular Formula: | C9H18ClNO |
| Molecular Weight: | 191.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Solid |
| Source: | The herbs of Salsola tetrandra |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C1CC(C)(C)NC(C1)(C)C.Cl |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 0.882g/cm3 |
| Boiling Point | 205.6ºC at 760mmHg |
| Flash Point | 73.2ºC |
| Exact Mass | 191.107697 |
| PSA | 29.10000 |
| LogP | 2.62690 |