Home
Products
Silychristin
| Product Name | Silychristin |
| Price: | $77 / 10mg |
| Catalog No.: | CN05198 |
| CAS No.: | 33889-69-9 |
| Molecular Formula: | C25H22O10 |
| Molecular Weight: | 482.44 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Silybum marianum (L.) Gaertn. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC[C@@H]1c2cc(cc(c2O[C@H]1c1ccc(c(c1)OC)O)O)[C@H]1Oc2cc(O)cc(c2C(=O)[C@@H]1O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Silychristin is an abundant flavonolignan present in the fruits of Silybum marianum, with antioxidant properties. Silychristin is a potent inhibitor of the thyroid hormone transporter MCT8, and elicits a strong inhibition of T3 uptake with an IC50 of 110 nM[1][2]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 782.0±60.0 °C at 760 mmHg |
| Flash Point | 270.5±26.4 °C |
| Exact Mass | 482.121307 |
| PSA | 166.14000 |
| LogP | 2.20 |
| Vapour Pressure | 0.0±2.8 mmHg at 25°C |
| Storage condition | 2-8°C |