Home
Products
Demethyl tetrandrine
| Product Name | Demethyl tetrandrine |
| Price: | Inquiry |
| Catalog No.: | CN01281 |
| CAS No.: | 33889-68-8 |
| Molecular Formula: | C37H40N2O6 |
| Molecular Weight: | 608.72 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The roots of Stephania tetrandra S.Moore. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc2CCN(C3c2c(c1O)Oc1cc2c(cc1OC)CCN(C2Cc1ccc(Oc2cc(C3)ccc2OC)cc1)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | (R)-Fangchinoline (Thalrugosine), a alkaloids from genus Stephania，exhibits antimicrobial and hypotensive activity. The roots and stems of several plants from genus Stephania are all used as traditional Chinese medicine and have been used for treatment of fever, diarrhea, dyspepsia and urinary disease[1]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 709.7±60.0 °C at 760 mmHg |
| Flash Point | 383.0±32.9 °C |
| Exact Mass | 608.288635 |
| PSA | 72.86000 |
| LogP | 3.78 |
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |