Home
Products
Voacanginine
| Product Name | Voacanginine |
| Price: | Inquiry |
| Catalog No.: | CN00729 |
| CAS No.: | 3371-85-5 |
| Molecular Formula: | C43H52N4O5 |
| Molecular Weight: | 704.91 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The herbs of Voacanga africana |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COC(=O)[C@H]1[C@H]2C[C@H](c3cc4[nH]c5c(c4cc3OC)CCN3[C@@H]4[C@]5(C[C@@H](C[C@@H]4CC)C3)C(=O)OC)c3c(C[C@@H]1N(C/C/2=CC)C)c1ccccc1[nH]3 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Voacamine, an indole alkaloid, isolated from Voacanga Africana, exhibits potent cannabinoid CB1 receptor antagonistic activity[1]. Voacamine also inhibits P-glycoprotein (P-gp) action in multidrug-resistant tumor cells[1]. |
| Density | 1.309g/cm3 |
| Exact Mass | 704.39400 |
| PSA | 99.89000 |
| LogP | 6.36470 |
| Storage condition | 2-8℃ |