Home
Products
Hypophyllanthin
| Product Name | Hypophyllanthin |
| Price: | Inquiry |
| Catalog No.: | CN02947 |
| CAS No.: | 33676-00-5 |
| Molecular Formula: | C24H30O7 |
| Molecular Weight: | 430.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Lignans |
| Physical Desc.: | Powder |
| Source: | The herbs of Phyllanthus niruri Linn. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COC[C@H]1Cc2cc(OC)c3c(c2[C@H]([C@@H]1COC)c1ccc(c(c1)OC)OC)OCO3 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Hypophyllanthin is a major lignan in Phyllanthus spp, with strong anti-inflammatory activity. Hypophyllanthin directly inhibits P-glycoprotein (P-gp) activity and did not interfere with multidrug resistance protein 2 (MRP2) activity[1][2]. |
| Target | P-gp[2] |
| In Vitro | Hypophyllanthin down-regulates COX-2, TNF-α, and IL-1β gene expressions in U937 macrophages by interfering with the activation of NF-κB, MAPKs, and Akt[1]. |
| Density | 1.158 |
| Boiling Point | 511.1±50.0 °C at 760 mmHg |
| Flash Point | 200.8±30.0 °C |
| Exact Mass | 430.199158 |
| PSA | 64.61000 |
| LogP | 3.77 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |