Home
Products
Desoxyrhapontigenin
| Product Name | Desoxyrhapontigenin |
| Price: | $92 / 20mg |
| Catalog No.: | CN03704 |
| CAS No.: | 33626-08-3 |
| Molecular Formula: | C15H14O3 |
| Molecular Weight: | 242.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The roots of Rheum palmatum L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1ccc(cc1)C=Cc1cc(O)cc(c1)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 4'-Methoxyresveratrol (4'-O-Methylresveratrol) is a polyphenol derived from Dipterocarpaceae, with antiandrogenic, antifungal and anti-inflammatory activities. 4'-Methoxyresveratrol alleviates AGE-induced inflammation through suppressing RAGE-mediated MAPK/NF-κB signaling pathway and NLRP3 inflammasome activation[1]. |
| Density | 1.252 |
| Boiling Point | 446.5±14.0 °C at 760 mmHg |
| Flash Point | 223.8±20.1 °C |
| Exact Mass | 242.094299 |
| PSA | 49.69000 |
| LogP | 3.62 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Storage condition | 2-8°C |