Home
Products
Myricanol
| Product Name | Myricanol |
| Price: | Inquiry |
| Catalog No.: | CN04055 |
| CAS No.: | 33606-81-4 |
| Molecular Formula: | C21H26O5 |
| Molecular Weight: | 358.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Oil |
| Source: | The root barks of Myrica cerifera L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1c2cc(c(c1OC)O)CCCC[C@@H](CCc1cc2c(O)cc1)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Myricanol is a constituent of Myrica cerifera (bayberry/southern wax myrtle) root bark. Myricanol can lower the levels of the microtubule-associated protein tau (MAPT)[1]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 583.5±50.0 °C at 760 mmHg |
| Flash Point | 306.7±30.1 °C |
| Exact Mass | 358.178009 |
| PSA | 79.15000 |
| LogP | 3.93 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |