Home
Products
Chrysoeriol 7-apiosylglucoside
| Product Name | Chrysoeriol 7-apiosylglucoside |
| Price: | $394 / 5mg |
| Catalog No.: | CN04463 |
| CAS No.: | 33579-63-4 |
| Molecular Formula: | C27H30O15 |
| Molecular Weight: | 594.52 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Eminium spiculatum |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@H](Oc2cc(O)c3c(c2)oc(cc3=O)c2ccc(cc2)O)[C@@H]([C@H]([C@@H]1O)O)O[C@@H]1OC[C@]([C@H]1OC)(O)CO |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 3'-Methoxyapiin (Graveobioside B) is a flavone. 3'-Methoxyapiin can be found in Uraria crinite and celery[1][2]. |
| Density | 1.72±0.1 g/cm3 |
| Exact Mass | 594.15800 |
| PSA | 238.20000 |