Home
Products
Fucoxanthin
| Product Name | Fucoxanthin |
| Price: | $161 / 10mg |
| Catalog No.: | CN06538 |
| CAS No.: | 3351-86-8 |
| Molecular Formula: | C42H58O6 |
| Molecular Weight: | 658.9 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Powder |
| Source: | The herbs of Laminaria japonica. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C/C(=CC=CC=C(C=CC=C(C(=O)C[C@]12O[C@]2(C)C[C@H](CC1(C)C)O)/C)/C)/C=C/C=C(/C=C=C1C(C)(C)C[C@@H](C[C@@]1(C)O)OC(=O)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Fucoxanthin is a marine carotenoid and shows anti-obesity, anti-diabetic, anti-oxidant, anti-inflammatory and anticancer activities. |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 786.5±60.0 °C at 760 mmHg |
| Flash Point | 228.5±26.4 °C |
| Exact Mass | 676.433899 |
| PSA | 96.36000 |
| LogP | 7.70 |
| Vapour Pressure | 0.0±6.2 mmHg at 25°C |
| Storage condition | ?20°C |