Home
Products
Tracheloside
| Product Name | Tracheloside |
| Price: | $109 / 20mg |
| Catalog No.: | CN02829 |
| CAS No.: | 33464-71-0 |
| Molecular Formula: | C27H34O12 |
| Molecular Weight: | 550.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Lignans |
| Physical Desc.: | Powder |
| Source: | The herbs of Trachelospermum jasminoides (Lindl.) Lem. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2ccc(cc2OC)C[C@@]2(O)C(=O)OC[C@@H]2Cc2ccc(c(c2)OC)OC)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Tracheloside is an antiestrogenic lignin. Tracheloside promotes keratinocyte proliferation through ERK1/2 stimulation. Tracheloside is a good candidate to promote wound healing[1]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 769.8±60.0 °C at 760 mmHg |
| Flash Point | 253.8±26.4 °C |
| Exact Mass | 550.205017 |
| PSA | 173.60000 |
| LogP | -0.54 |
| Vapour Pressure | 0.0±2.8 mmHg at 25°C |