Home
Products
Evonine
| Product Name | Evonine |
| Price: | Inquiry |
| Catalog No.: | CN09334 |
| CAS No.: | 33458-82-1 |
| Molecular Formula: | C38H47NO18 |
| Molecular Weight: | 805.8 g/mol |
| Purity: | >=98% |
| Type of Compound: | Sesquiterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Euonymus alatus |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)OCC12C(OC(=O)C)C(OC(=O)C)C3C(C42OC(C(C(C1OC(=O)C)OC(=O)C)C4OC(=O)C)(C)COC(=O)c1c(C(C(C(=O)O3)C)C)nccc1)(C)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Euonymine (Euonymin) is a sesquiterpene pyridine alkaloid isolated from the leaves of Maytenus chiapensis. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 799.6±60.0 °C at 760 mmHg |
| Flash Point | 437.4±32.9 °C |
| Exact Mass | 805.279297 |
| LogP | 3.96 |
| Vapour Pressure | 0.0±3.0 mmHg at 25°C |