Home
Products
Alnustone
| Product Name | Alnustone |
| Price: | $77 / 20mg |
| Catalog No.: | CN03765 |
| CAS No.: | 33457-62-4 |
| Molecular Formula: | C19H18O |
| Molecular Weight: | 262.35 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The seeds of Alpinia katsumadai Hayata. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C(CCc1ccccc1)/C=C/C=C/c1ccccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Alnustone, a non-phenolic diarylheptanoid found in herbs and spices, is a constituent of Curcuma xanthorrhiza. Alnustone displays anti-emetic and anti-inflammatory activities[1][2]. |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 442.9±34.0 °C at 760 mmHg |
| Flash Point | 170.9±24.9 °C |
| Exact Mass | 262.135773 |
| PSA | 17.07000 |
| LogP | 4.16 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |