Home
Products
Gartanin
| Product Name | Gartanin |
| Price: | $176 / 10mg |
| Catalog No.: | CN05827 |
| CAS No.: | 33390-42-0 |
| Molecular Formula: | C23H24O6 |
| Molecular Weight: | 396.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Xanthones |
| Physical Desc.: | Yellow powder |
| Source: | The stem barks of Garcinia mangostana |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=CCc1c(O)c(CC=C(C)C)c(c2c1oc1c(O)ccc(c1c2=O)O)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Gartanin is a natural xanthone of mangosteen, with antioxidant, anti-inflammatory, antifungal, neuroprotective and antineoplastic properties. Gartanin induces cell cycle arrest and autophagy and suppresses migration in human glioma cells[1][2]. |
| In Vitro | Gartanin is a potential agent against glutamate-induced oxidative injury partially through increasing Nrf-2-independed HO-1 and AMPK/SIRT1/PGC-1α signaling pathways [1]. Gartanin induces cell cycle arrest and autophagy and suppresses migration involving PI3K/Akt/mTOR and MAPK signalling pathway in human glioma cells [1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 644.4±55.0 °C at 760 mmHg |
| Flash Point | 224.9±25.0 °C |
| Exact Mass | 396.157288 |
| PSA | 111.13000 |
| LogP | 4.51 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |