Home
Products
8-Deoxygartanin
| Product Name | 8-Deoxygartanin |
| Price: | $190 / 5mg |
| Catalog No.: | CN05828 |
| CAS No.: | 33390-41-9 |
| Molecular Formula: | C23H24O5 |
| Molecular Weight: | 380.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Xanthones |
| Physical Desc.: | Yellow powder |
| Source: | The stem barks of Garcinia mangostana |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=CCc1c(O)c(CC=C(C)C)c(c2c1oc1c(O)cccc1c2=O)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 8-Deoxygartanin, a prenylated xanthones from G. mangostana, is a selective inhibitor of butyrylcholinesterase (BChE)[1]. 8-Deoxygartanin exhibits antiplasmodial activity with an IC50 of 11.8 μM for the W2 strain of Plasmodium falciparum[2]. 8-Deoxygartanin inhibits NF-κB (p65) activation with an IC50 of 11.3 μM[3]. |
| Target | p65:11.3 μM (IC50) |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 595.7±50.0 °C at 760 mmHg |
| Flash Point | 207.2±23.6 °C |
| Exact Mass | 380.162384 |
| PSA | 90.90000 |
| LogP | 5.35 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |