Home
Products
Theaflavine-3,3'-digallate
| Product Name | Theaflavine-3,3'-digallate |
| Price: | $293 / 10mg |
| Catalog No.: | CN05329 |
| CAS No.: | 33377-72-9 |
| Molecular Formula: | C43H32O20 |
| Molecular Weight: | 868.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The leaves of Camellia sinensis (L.) O. Kuntze. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | Oc1cc2OC(C(Cc2c(c1)O)OC(=O)c1cc(O)c(c(c1)O)O)c1cc2c(cc(c(c2c(c(=O)c1)O)O)O)C1Oc2cc(O)cc(c2CC1OC(=O)c1cc(O)c(c(c1)O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Theaflavine-3,3'-digallate, a bioactive black tea phenolic, can be used for the research of gut microbiota composition modulatory effects[1]. |
| Density | 2.0±0.1 g/cm3 |
| Boiling Point | 1352.6±65.0 °C at 760 mmHg |
| Flash Point | 411.0±27.8 °C |
| Exact Mass | 868.148682 |
| PSA | 351.12000 |
| LogP | 6.23 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |