Home
Products
Rutaevin
| Product Name | Rutaevin |
| Price: | $234 / 10mg |
| Catalog No.: | CN07458 |
| CAS No.: | 33237-37-5 |
| Molecular Formula: | C26H30O9 |
| Molecular Weight: | 486.51 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The root barks of Dictamnus dasycarpus. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C1OCC23C(C1)OC(C2C(=O)C(C1(C3CCC2(C31OC3C(=O)OC2c1cocc1)C)C)O)(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Rutaevin is isolated from the fruits of Euodia rutaecarpa. Rutaevin inhibits NO production in LPS-induced RAW 264.7 macrophages[1]. |
| Target | IC50: NO production[1] |
| Density | 1.44g/cm3 |
| Boiling Point | 714.9ºC at 760 mmHg |
| Flash Point | 386.2ºC |
| Exact Mass | 486.18900 |
| PSA | 124.80000 |
| LogP | 2.10820 |