Home
Products
trans-2,3,4-Trimethoxycinnamic acid
| Product Name | trans-2,3,4-Trimethoxycinnamic acid |
| Price: | Inquiry |
| Catalog No.: | CN06975 |
| CAS No.: | 33130-03-9 |
| Molecular Formula: | C12H14O5 |
| Molecular Weight: | 238.24 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenylpropanoids |
| Physical Desc.: | Powder |
| Source: | The barks of Chinese cinnamon |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1c(C=CC(=O)O)ccc(c1OC)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 392.2±37.0 °C at 760 mmHg |
| Flash Point | 149.7±20.0 °C |
| Exact Mass | 238.084122 |
| PSA | 64.99000 |
| LogP | 2.03 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |