Home
Products
Kumatakenin
| Product Name | Kumatakenin |
| Price: | $453 / 10mg |
| Catalog No.: | CN05407 |
| CAS No.: | 3301-49-3 |
| Molecular Formula: | C17H14O6 |
| Molecular Weight: | 314.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The roots of Astragalus membranaceus |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1c(oc2c(c1=O)c(O)cc(c2)OC)c1ccc(cc1)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Kumatakenin, a flavonoid that is isolated from cloves shows the effect of inducing apoptosis in ovarian cancer cells[1]. |
| Target | IC50: apoptosis[1] |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 578.4±50.0 °C at 760 mmHg |
| Flash Point | 217.4±23.6 °C |
| Exact Mass | 314.079041 |
| PSA | 89.13000 |
| LogP | 2.79 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |