Home
Products
Withanolide A
| Product Name | Withanolide A |
| Price: | $439 / 5mg |
| Catalog No.: | CN02348 |
| CAS No.: | 32911-62-9 |
| Molecular Formula: | C28H38O6 |
| Molecular Weight: | 470.60 g/mol |
| Purity: | >=98% |
| Type of Compound: | Steroids |
| Physical Desc.: | Powder |
| Source: | The herbs of Physali alkekengi |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC1=C(C)C(=O)O[C@H](C1)[C@@]([C@H]1CC[C@@H]2[C@]1(C)CC[C@H]1[C@H]2[C@@H]2O[C@@H]2[C@@]2([C@]1(C)C(=O)C=CC2)O)(O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Withanolide A, isolated from the indian herbal drug Ashwagandha (root of Withania somnifera), could regenerate neurites and reconstruct synapses in severely damaged neurons[1]. |
| Density | 1.264 |
| Boiling Point | 651.6±55.0 °C(Predicted) |
| Exact Mass | 470.26700 |
| PSA | 96.36000 |
| LogP | 3.49540 |
| Storage condition | ?20°C |