Home
Products
Edpetiline
| Product Name | Edpetiline |
| Price: | $234 / 5mg |
| Catalog No.: | CN00965 |
| CAS No.: | 32685-93-1 |
| Molecular Formula: | C33H53NO8 |
| Molecular Weight: | 591.8 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The herbs of Petilium eduardi. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](O[C@H]2CC[C@]3([C@H](C2)C(=O)C[C@@H]2[C@@H]3C[C@@H]3[C@H]2CC[C@H]2[C@H]3CN3C[C@@H](C)CC[C@H]3[C@@]2(C)O)C)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Edpetiline is a principal alkaloid from P. eduardi. Edpetiline has significant antiinflammatory effects[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 742.7±60.0 °C at 760 mmHg |
| Flash Point | 403.0±32.9 °C |
| Exact Mass | 591.377136 |
| PSA | 139.92000 |
| LogP | 1.85 |
| Vapour Pressure | 0.0±5.6 mmHg at 25°C |
| Storage condition | 2-8C |